PPIRE09119
Target Protein Information
| Protein_Name | Suppressor protein STP22 of temperature-sensitive alpha-factor receptor and arginine permease |
|---|---|
| Protein_Sequence | MSANGKISVPEAVVNWLFKVIQPIYNDGRTTFHDSLALLDNFHSLRPRTRVFTHSDGTPQLLLSIYGTISTGEDGSSPHSIPVIMWVPSMYPVKPPFISINLENFDMNTISSSLPIQEYIDSNGWIALPILHCWDPAAMNLIMVVQELMSLLHEPPQDQAPSLPPKPNTQLQQEQNTPPLPPKPKSPHLKPPLPPPPPPQPASNALDLMDMDNTDISPTNHHEMLQNLQTVVNELYREDVDYVADKILTRQTVMQESIARFHEIIAIDKNHLRAVEQAIEQTMHSLNAQIDVLTANRAKVQQFSSTSHVDDEDVNSIAVAKTDGLNQLYNLVAQDYALTDTIECLSRMLHRGTIPLDTFVKQGRELARQQFLVRWHIQRITSPLS |
| Organism_Source | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) |
| Functional_Classification | ESCRT-I complex subunit (UEV-domain scaffold) |
| Cellular_Localization | Cytoplasm |
| Gene_Names | STP22 |
| UniProt_ID | P25604 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Vps27-PSDP1 |
|---|---|
| Peptide_Sequence | QVPSDPYNY |
| Peptide_Length | 9 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1082.13 |
|---|---|
| Aliphatic_Index | 32.22222 |
| Aromaticity | 0.22222 |
| Average_Rotatable_Bonds | 3.11111 |
| Charge_at_pH_7 | -1.00327 |
| Isoelectric_Point | 3.74999 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 16 |
| Number_of_Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 462.71000 |
| X_logP_energy | -4.55040 |
Interaction Information
| Affinity | KD=84 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis for endosomal recruitment of ESCRT-I by ESCRT-0 in yeast. |
| Release_Year | 2011 |
| PMID | 21505419 |
| DOI | 10.1038/emboj.2011.122 |