PPIRE09219
Target Protein Information
| Protein_Name | AH receptor-interacting protein |
|---|---|
| Protein_Sequence | MADIIARLREDGIQKRVIQEGRGELPDFQDGTKATFHYRTLHSDDEGTVLDDSRARGKPMELIIGKKFKLPVWETIVCTMREGEIAQFLCDIKHVVLYPLVAKSLRNIAVGKDPLEGQRHCCGVAQMREHSSLGHADLDALQQNPQPLIFHMEMLKVESPGTYQQDPWAMTDEEKAKAVPLIHQEGNRLYREGHVKEAAAKYYDAIACLKNLQMKEQPGSPEWIQLDQQITPLLLNYCQCKLVVEEYYEVLDHCSSILNKYDDNVKAYFKRGKAHAAVWNAQEAQADFAKVLELDPALAPVVSRELRALEARIRQKDEEDKARFRGIFSH |
| Organism_Source | Homo sapiens |
| Functional_Classification | TPR-domain co-chaperones |
| Cellular_Localization | Cytoplasm |
| Gene_Names | AIP |
| UniProt_ID | O00170 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | AQSLAEDDVE |
|---|---|
| Peptide_Sequence | AQSLAEDDVE |
| Peptide_Length | 10 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](C)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1076.08 |
|---|---|
| Aliphatic_Index | 88.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.60000 |
| Charge_at_pH_7 | -3.99757 |
| Isoelectric_Point | 3.29497 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 17 |
| Number_of_Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 537.74000 |
| X_logP_energy | -6.55980 |
Interaction Information
| Affinity | KD=22.5 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of the TPR domain of AIP: lack of client protein interaction with the C-terminal Alpha-7 helix of the TPR domain of AIP is sufficient for pituitary adenoma predisposition. |
| Release_Year | 2012 |
| PMID | 23300914 |
| DOI | 10.1371/journal.pone.0053339 |