PPIRE09287
Target Protein Information
| Protein_Name | SAGA-associated factor 29 |
|---|---|
| Protein_Sequence | MALVSADSRIAELLTELHQLIKQTQEERSRSEHNLVNIQKTHERMQTENKISPYYRTKLRGLYTTAKADAEAECNILRKALDKIAEIKSLLEERRIAAKIAGLYNDSEPPRKTMRRGVLMTLLQQSAMTLPLWIGKPGDKPPPLCGAIPASGDYVARPGDKVAARVKAVDGDEQWILAEVVSYSHATNKYEVDDIDEEGKERHTLSRRRVIPLPQWKANPETDPEALFQKEQLVLALYPQTTCFYRALIHAPPQRPQDDYSVLFEDTSYADGYSPPLNVAQRYVVACKEPKKK |
| Organism_Source | Homo sapiens |
| Functional_Classification | tandem tudor domain |
| Cellular_Localization | Nucleus |
| Gene_Names | SGF29 |
| UniProt_ID | Q96ES7 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3K4me3 |
|---|---|
| Peptide_Sequence | ARTXQTARKS |
| Peptide_Length | 10 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | X4=trimethyllysine |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1075.19 |
|---|---|
| Aliphatic_Index | 20.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.70000 |
| Charge_at_pH_7 | 2.99768 |
| Isoelectric_Point | 12.51648 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 18 |
| Number_of_Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 578.82000 |
| X_logP_energy | -9.89236 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Chemical basis for the recognition of trimethyllysine by epigenetic reader proteins. |
| Release_Year | 2015 |
| PMID | 26578293 |
| DOI | 10.1038/ncomms9911 |