PPIRE09456
Target Protein Information
| Protein_Name | Tropomyosin alpha-1 chain |
|---|---|
| Protein_Sequence | MDAIKKKMQMLKLDKENALDRAEQAEADKKAAEERSKQLEDELVALQKKLKGTEDELDKYSESLKDAQEKLELADKKATDAESEVASLNRRIQLVEEELDRAQERLATALQKLEEAEKAADESERGMKVIENRAQKDEEKMEIQEIQLKEAKHIAEEADRKYEEVARKLVIIEGDLERAEERAELSESKCAELEEELKTVTNNLKSLEAQAEKYSQKEDKYEEEIKVLTDKLKEAETRAEFAERSVTKLEKSIDDLEDELYAQKLKYKAISEELDHALNDMTSI |
| Organism_Source | Gallus gallus |
| Functional_Classification | actin-binding proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | TPM1 |
| UniProt_ID | P04268 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Ac-(HHPHG)2-NH2 |
|---|---|
| Peptide_Sequence | HHPHGHHPHG |
| Peptide_Length | 10 |
| Peptide_SMILES | N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)NCC(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1149.20 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.90000 |
| Charge_at_pH_7 | 0.54344 |
| Isoelectric_Point | 7.97858 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 17 |
| Number_of_Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 479.72000 |
| X_logP_energy | -5.16850 |
Interaction Information
| Affinity | IC50=26.9 uM |
|---|---|
| Affinity_Assay | solid-phase competition binding assay |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Evaluation of an 111In-radiolabeled peptide as a targeting and imaging agent for ErbB-2 receptor expressing breast carcinomas. |
| Release_Year | 2004 |
| PMID | None |
| DOI | 10.1158/0008-5472.CAN-04-0755 |