PPIRE09539
Target Protein Information
| Protein_Name | Na(+)/H(+)exchange regulatory cofactor NHE-RF3 |
|---|---|
| Protein_Sequence | MTSTFNPRECKLSKQEGQNYGFFLRIEKDTEGHLVRVVEKCSPAEKAGLQDGDRVLRINGVFVDKEEHMQVVDLVRKSGNSVTLLVLDGDSYEKAVKTRVDLKELGQSQKEQGLSDNILSPVMNGGVQTWTQPRLCYLVKEGGSYGFSLKTVQGKKGVYMTDITPQGVAMRAGVLADDHLIEVNGENVEDASHEEVVEKVKKSGSRVMFLLVDKETDKRHVEQKIQFKRETASLKLLPHQPRIVEMKKGSNGYGFYLRAGSEQKGQIIKDIDSGSPAEEAGLKNNDLVVAVNGESVETLDHDSVVEMIRKGGDQTSLLVVDKETDNMYRLAHFSPFLYYQSQELPNGSVKEAPAPTPTSLEVSSPPDTTEEVDHKPKLCRLAKGENGYGFHLNAIRGLPGSFIKEVQKGGPADLAGLEDEDVIIEVNGVNVLDEPYEKVVDRIQSSGKNVTLLVCGKKAYDYFQAKKIPIVSSLADPLDTPPDSKEGIVVESNHDSHMAKERAHSTASHSSSNSEDTEM |
| Organism_Source | Homo sapiens |
| Functional_Classification | scaffolding proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | PDZK1 |
| UniProt_ID | Q5T2W1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PEPT1-CT |
|---|---|
| Peptide_Sequence | MSGANSQKQM |
| Peptide_Length | 10 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](C)NC(=O)CNC(=O)[C@H](CO)NC(=O)[C@@H](N)CCSC)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | N-Fitc |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1081.23 |
|---|---|
| Aliphatic_Index | 10.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.90000 |
| Charge_at_pH_7 | 0.99769 |
| Isoelectric_Point | 9.70000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 19 |
| Number_of_Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 520.97000 |
| X_logP_energy | -8.56100 |
Interaction Information
| Affinity | KD=286 mM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Probing the Architecture of a Multi-PDZ Domain Protein: Structure of PDZK1 in Solution. |
| Release_Year | 2018 |
| PMID | 30220543 |
| DOI | 10.1016/j.str.2018.07.016 |