PPIRE10054
Target Protein Information
| Protein_Name | Protein farnesyltransferase subunit beta |
|---|---|
| Protein_Sequence | MASSSSFTYYCPPSSSPVWSEPLYSLRPEHARERLQDDSVETVTSIEQAKVEEKIQEVFSSYKFNHLVPRLVLQREKHFHYLKRGLRQLTDAYECLDASRPWLCYWILHSLELLDEPIPQIVATDVCQFLELCQSPDGGFGGGPGQYPHLAPTYAAVNALCIIGTEEAYNVINREKLLQYLYSLKQPDGSFLMHVGGEVDVRSAYCAASVASLTNIITPDLFEGTAEWIARCQNWEGGIGGVPGMEAHGGYTFCGLAALVILKKERSLNLKSLLQWVTSRQMRFEGGFQGRCNKLVDGCYSFWQAGLLPLLHRALHAQGDPALSMSHWMFHQQALQEYILMCCQCPAGGLLDKPGKSRDFYHTCYCLSGLSIAQHFGSGAMLHDVVMGVPENVLQPTHPVYNIGPDKVIQATTHFLQKPVPGFEECEDAVTSDPATD |
| Organism_Source | Rattus norvegicus |
| Functional_Classification | prenyltransferases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Fntb |
| UniProt_ID | Q02293 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | KKKSKTKCVIM |
|---|---|
| Peptide_Sequence | KKKSKTKCVIM |
| Peptide_Length | 11 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)[C@@H](C)O)C(C)C)C(=O)N[C@@H](CCSC)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1293.69 |
|---|---|
| Aliphatic_Index | 61.81818 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.54545 |
| Charge_at_pH_7 | 4.93453 |
| Isoelectric_Point | 10.97880 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 21 |
| Number_of_Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 524.88000 |
| X_logP_energy | -4.35060 |
Interaction Information
| Affinity | IC50=50 nM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | 1D8D |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification, functional gastrointestinal stability and molecular docking studies of lentil peptides with dual antioxidant and angiotensin I converting enzyme inhibitory activities. |
| Release_Year | 2000 |
| PMID | None |
| DOI | 10.1016/S0969-2126(00)80012-8 |