PPIRE10066
Target Protein Information
| Protein_Name | ATP-dependent Clp protease adapter protein ClpS |
|---|---|
| Protein_Sequence | MGKTNDWLDFDQLAEEKVRDALKPPSMYKVILVNDDYTPMEFVIDVLQKFFSYDVERATQLMLAVHYQGKAICGVFTAEVAETKVAMVNKYARENEHPLLCTLEKA |
| Organism_Source | Escherichia coli (strain SE11) |
| Functional_Classification | proteolytic adaptors |
| Cellular_Localization | Cytoplasm |
| Gene_Names | clpS |
| UniProt_ID | B6I8V2 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | LLYVQRDSKEC |
|---|---|
| Peptide_Sequence | LLYVQRDSKEC |
| Peptide_Length | 11 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(C)C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CS)C(=O)O)C(C)C |
| Chemical_Modification | C11=fluorescein |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1353.56 |
|---|---|
| Aliphatic_Index | 97.27273 |
| Aromaticity | 0.09091 |
| Average_Rotatable_Bonds | 4.18182 |
| Charge_at_pH_7 | -0.06292 |
| Isoelectric_Point | 6.31437 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 20 |
| Number_of_Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 600.39000 |
| X_logP_energy | -5.13783 |
Interaction Information
| Affinity | KD=214 nM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | 3GQ1 |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Molecular basis of substrate selection by the N-end rule adaptor protein ClpS. |
| Release_Year | 2009 |
| PMID | 19451643 |
| DOI | 10.1073/pnas.0903614106 |