PPIRE10260
Target Protein Information
| Protein_Name | Calcitonin gene-related peptide type 1 receptor |
|---|---|
| Protein_Sequence | MEKMCVLYFLFLLPFVMCLATAEPEEQSNDTMHLRVTRNKIMTAQYECYQKIMQDPVQQIEGIYCNRTWDGWLCWNDVAAGTESMQHCPDYFQDFDPSEKVTKICNKDGNWFRHPESNRTWTNYTQCNVNTPEKVKTALNLFYLTIIGHGLSITSLVISLGIFFYFKSLSCQRITLHKNLFFSFVCNSTVTIIHFTAVANNQALVATNPVSCKVSQFIHLYLLGCNYFWMLCEGIYLHTLIVVAVFAEKQHLIWYYFLGWGFPLIPACIHAIARSLYYNDNCWISFDTHLLYIIHGPICAALLVNLFFLLNIVRVLITKLKVTHQAESHLYMKAVRATLILVPLLGIEFVLLPWRPEGRIAEEVYDYIMHILMHFQGLLVSTIFCFFNGEVQAILRRNWNQYKIQFGHSFSHSDALRSASYTVSTISDGPGFSHDCASEHLNGKSIHDTDNMVLKPEKLKDLAI |
| Organism_Source | Cavia porcellus |
| Functional_Classification | G protein-coupled receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CALCRL |
| UniProt_ID | H0UV86 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Tyr CGRP(28-37) |
|---|---|
| Peptide_Sequence | YVPTNVSGEAF |
| Peptide_Length | 11 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(C)C)[C@@H](C)O)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1183.28 |
|---|---|
| Aliphatic_Index | 61.81818 |
| Aromaticity | 0.18182 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -1.00109 |
| Isoelectric_Point | 3.84998 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 17 |
| Number_of_Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 486.61000 |
| X_logP_energy | -4.97990 |
Interaction Information
| Affinity | IC50=10 uM |
|---|---|
| Affinity_Assay | radioligand binding assay |
| PDB_ID | None |
| Type | antagonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Activities of calcitonin gene-related peptide (CGRP)and related peptides at the CGRP receptor. |
| Release_Year | 1990 |
| PMID | 1696374 |
| DOI | 10.1016/0196-9781(90)90047-9 |