PPIRE10399
Target Protein Information
| Protein_Name | Hepatoma-derived growth factor-related protein 3 |
|---|---|
| Protein_Sequence | MARPRPREYKAGDLVFAKMKGYPHWPARIDELPEGAVKPPANKYPIFFFGTHETAFLGPKDLFPYKEYKDKFGKSNKRKGFNEGLWEIENNPGVKFTGYQAIQQQSSSETEGEGGNTADASSEEEGDRVEEDGKGKRKNEKAGSKRKKSYTSKKSSKQSRKSPGDEDDKDCKEEENKSSSEGGDAGNDTRNTTSDLQKTSEGT |
| Organism_Source | Homo sapiens |
| Functional_Classification | histone readers |
| Cellular_Localization | Nucleus |
| Gene_Names | HDGFL3 |
| UniProt_ID | Q9Y3E1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3K79me2 |
|---|---|
| Peptide_Sequence | EIAQDFXTDLRY |
| Peptide_Length | 12 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O |
| Chemical_Modification | X7=N6-dimethyllysine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1427.53 |
|---|---|
| Aliphatic_Index | 73.33333 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 3.83333 |
| Charge_at_pH_7 | -2.00020 |
| Isoelectric_Point | 3.87601 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 20 |
| Number_of_Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 640.77000 |
| X_logP_energy | -5.61063 |
Interaction Information
| Affinity | KD=0.9 mM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural and histone binding ability characterizations of human PWWP domains. |
| Release_Year | 2011 |
| PMID | 21720545 |
| DOI | 10.1371/journal.pone.0018919 |