PPIRE10467
Target Protein Information
| Protein_Name | Inhibitor of growth protein 5 |
|---|---|
| Protein_Sequence | MATAMYLEHYLDSIENLPCELQRNFQLMRELDQRTEDKKAEIDILAAEYISTVKTLSPDQRVERLQKIQNAYSKCKEYSDDKVQLAMQTYEMVDKHIRRLDADLARFEADLKDKMEGSDFESSGGRGLKKGRGQKEKRGSRGRGRRTSEEDTPKKKKHKGGSEFTDTILSVHPSDVLDMPVDPNEPTYCLCHQVSYGEMIGCDNPDCPIEWFHFACVDLTTKPKGKWFCPRCVQEKRKKK |
| Organism_Source | Homo sapiens |
| Functional_Classification | PHD finger |
| Cellular_Localization | Nucleus |
| Gene_Names | ING5 |
| UniProt_ID | Q8WYH8 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3K4me2 |
|---|---|
| Peptide_Sequence | ARTXQTARKSTG |
| Peptide_Length | 12 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)NCC(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | X4=dimethyllysine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1233.35 |
|---|---|
| Aliphatic_Index | 16.66667 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | 2.99768 |
| Isoelectric_Point | 12.51648 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 21 |
| Number_of_Hydrogen_Bond_Donors | 25 |
| Topological_Polar_Surface_Area | 657.25000 |
| X_logP_energy | -11.91056 |
Interaction Information
| Affinity | KD=16 uM |
|---|---|
| Affinity_Assay | tryptophan fluorescence spectroscopy |
| PDB_ID | 3C6W |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The crystal structure of the ING5 PHD finger in complex with an H3K4me3 histone peptide. |
| Release_Year | 2008 |
| PMID | 18623064 |
| DOI | 10.1002/prot.22140 |