PPIRE10530
Target Protein Information
| Protein_Name | WD repeat-containing protein 5 |
|---|---|
| Protein_Sequence | MATEEKKPETEAARAQPTPSSSATQSKPTPVKPNYALKFTLAGHTKAVSSVKFSPNGEWLASSSADKLIKIWGAYDGKFEKTISGHKLGISDVAWSSDSNLLVSASDDKTLKIWDVSSGKCLKTLKGHSNYVFCCNFNPQSNLIVSGSFDESVRIWDVKTGKCLKTLPAHSDPVSAVHFNRDGSLIVSSSYDGLCRIWDTASGQCLKTLIDDDNPPVSFVKFSPNGKYILAATLDNTLKLWDYSKGKCLKTYTGHKNEKYCIFANFSVTGGKWIVSGSEDNLVYIWNLQTKEIVQKLQGHTDVVISTACHPTENIIASAALENDKTIKLWKSDC |
| Organism_Source | Homo sapiens |
| Functional_Classification | WD40 repeat proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | WDR5 |
| UniProt_ID | P61964 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MLL3Win |
|---|---|
| Peptide_Sequence | GCSRAEVGPPLL |
| Peptide_Length | 12 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CO)NC(=O)[C@H](CS)NC(=O)CN)C(C)C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1198.40 |
|---|---|
| Aliphatic_Index | 97.50000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.91667 |
| Charge_at_pH_7 | -0.06222 |
| Isoelectric_Point | 6.23243 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 17 |
| Number_of_Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 485.27000 |
| X_logP_energy | -5.17543 |
Interaction Information
| Affinity | KD=2.03 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3UVM |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The plasticity of WDR5 peptide-binding cleft enables the binding of the SET1 family of histone methyltransferases. |
| Release_Year | 2012 |
| PMID | 22266653 |
| DOI | 10.1093/nar/gkr1235 |