PPIRE11103
Target Protein Information
| Protein_Name | Protein Dok-7 |
|---|---|
| Protein_Sequence | MTEAALVEGQVKLRDGKKWKSRWLVLRKPSPVADCLLMLVYKDKCERSKGLRERSSLTLEDICGLEPALPYEGLAHTLAIICLSQAVMLGFDSHEAMCAWDTRIRYALGEVHRFHVTVAPGTKLESGPATLHLCNDILVLARDIPPTVMGQWKLSDLRRYGAVPNGFIFEGGTRCGYWAGVFFLSSAEGEQMSFLFDCIVRGISPTKGPFGLRPVLPDPSSGGPSASEERVAQEALEALQLEKRLSLLSHSGRPGSGGDDRSLSSSSSEASHSDISASSRLTAWPEQSSSSAGTSQEGPGLVAAQGPGEAMLGASRPPLKPLRPRQLQEVGRQSSSDSGIATGSHSSYSGSFSSYAGSNLDVWRAGEEFGSLLSLPPGASAPEPRLCACPPGAAEYQVPTSLRHHYDTPRSLRQAPRDPSPASQGSSDHGSATDLGGQAPTGCPSSWLGARRRGQATEGPGSDAALPSPSPGESWEAGSPHAGPPPAFFLSCSICGGLKVKPPP |
| Organism_Source | Mus musculus |
| Functional_Classification | PTB domain-containing proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Dok7 |
| UniProt_ID | Q18PE0 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MuSK pTyr553 phosphopeptide |
|---|---|
| Peptide_Sequence | LDRLHPNPMXQRM |
| Peptide_Length | 13 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCSC)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CC(C)C)C(=O)O |
| Chemical_Modification | X10=phosphotyrosine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1564.84 |
|---|---|
| Aliphatic_Index | 60.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.84615 |
| Charge_at_pH_7 | 1.08933 |
| Isoelectric_Point | 10.39953 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 22 |
| Number_of_Hydrogen_Bond_Donors | 22 |
| Topological_Polar_Surface_Area | 670.90000 |
| X_logP_energy | -6.43396 |
Interaction Information
| Affinity | KD=4.7 mM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3ML4 |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The cytoplasmic adaptor protein Dok7 activates the receptor tyrosine kinase MuSK via dimerization. |
| Release_Year | 2010 |
| PMID | 20603078 |
| DOI | 10.1016/j.molcel.2010.06.007 |