PPIRE11114
Target Protein Information
| Protein_Name | HLA class I histocompatibility antigen, B alpha chain |
|---|---|
| Protein_Sequence | MLVMAPRTVLLLLSAALALTETWAGSHSMRYFYTSVSRPGRGEPRFISVGYVDDTQFVRFDSDAASPREEPRAPWIEQEGPEYWDRNTQIYKAQAQTDRESLRNLRGYYNQSEAGSHTLQSMYGCDVGPDGRLLRGHDQYAYDGKDYIALNEDLRSWTAADTAAQITQRKWEAAREAEQRRAYLEGECVEWLRRYLENGKDKLERADPPKTHVTHHPISDHEATLRCWALGFYPAEITLTWQRDGEDQTQDTELVETRPAGDRTFQKWAAVVVPSGEEQRYTCHVQHEGLPKPLTLRWEPSSQSTVPIVGIVAGLAVLAVVVIGAVVAAVMCRRKSSGGKGGSYSQAACSDSAQGSDVSLTA |
| Organism_Source | Homo sapiens |
| Functional_Classification | MHC class I molecules |
| Cellular_Localization | Plasma membrane |
| Gene_Names | HLA-B |
| UniProt_ID | P01889 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | LPEP |
|---|---|
| Peptide_Sequence | LPEPLPQGQLTAY |
| Peptide_Length | 13 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CC(C)C)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1426.63 |
|---|---|
| Aliphatic_Index | 97.69231 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 3.07692 |
| Charge_at_pH_7 | -1.00109 |
| Isoelectric_Point | 3.84998 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 19 |
| Number_of_Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 550.09000 |
| X_logP_energy | -3.75100 |
Interaction Information
| Affinity | KD=25 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 4JRY |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Highly divergent T-cell receptor binding modes underlie specific recognition of a bulged viral peptide bound to a human leukocyte antigen class I molecule. |
| Release_Year | 2013 |
| PMID | 23569211 |
| DOI | 10.1074/jbc.M112.447185 |