PPIRE11179
Target Protein Information
| Protein_Name | Adapter molecule crk |
|---|---|
| Protein_Sequence | MAGNFDSEERSSWYWGRLSRQEAVALLQGQRHGVFLVRDSSTSPGDYVLSVSENSRVSHYIINSSGPRPPVPPSPAQPPPGVSPSRLRIGDQEFDSLPALLEFYKIHYLDTTTLIEPVSRSRQGSGVILRQEEAEYVRALFDFNGNDEEDLPFKKGDILRIRDKPEEQWWNAEDSEGKRGMIPVPYVEKYRPASASVSALIGGNQEGSHPQPLGGPEPGPYAQPSVNTPLPNLQNGPIYARVIQKRVPNAYDKTALALEVGELVKVTKINVSGQWEGECNGKRGHFPFTHVRLLDQQNPDEDFS |
| Organism_Source | Homo sapiens |
| Functional_Classification | Src homology 3 domain |
| Cellular_Localization | Cytoplasm |
| Gene_Names | CRK |
| UniProt_ID | P46108 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PRM524 |
|---|---|
| Peptide_Sequence | QAPELPTKTRTSY |
| Peptide_Length | 13 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)[C@H](C)NC(=O)[C@@H](N)CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1491.66 |
|---|---|
| Aliphatic_Index | 37.69231 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 3.46154 |
| Charge_at_pH_7 | 0.99861 |
| Isoelectric_Point | 9.29736 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 23 |
| Number_of_Hydrogen_Bond_Donors | 23 |
| Topological_Polar_Surface_Area | 664.40000 |
| X_logP_energy | -8.10013 |
Interaction Information
| Affinity | KD=1.72 mM |
|---|---|
| Affinity_Assay | fluorescence spectroscopy |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Binding Mechanism of the N-Terminal SH3 Domain of CrkII and Proline-Rich Motifs in cAbl. |
| Release_Year | 2016 |
| PMID | 27332121 |
| DOI | 10.1016/j.bpj.2016.05.008 |