PPIRE11215
Target Protein Information
| Protein_Name | SH2/SH3 adapter protein NCK1 |
|---|---|
| Protein_Sequence | MAEEVVVVAKFDYVAQQEQELDIKKNERLWLLDDSKSWWRVRNSMNKTGFVPSNYVERKNSARKASIVKNLKDTLGIGKVKRKPSVPDSASPADDSFVDPGERLYDLNMPAYVKFNYMAEREDELSLIKGTKVIVMEKCSDGWWRGSYNGQVGWFPSNYVTEEGDSPLGDHVGSLSEKLAAVVNNLNTGQVLHVVQALYPFSSSNDEELNFEKGDVMDVIEKPENDPEWWKCRKINGMVGLVPKNYVTVMQNNPLTSGLEPSPPQCDYIRPSLTGKFAGNPWYYGKVTRHQAEMALNERGHEGDFLIRDSESSPNDFSVSLKAQGKNKHFKVQLKETVYCIGQRKFSTMEELVEHYKKAPIFTSEQGEKLYLVKHLS |
| Organism_Source | Homo sapiens |
| Functional_Classification | SH2 domain-containing adapter proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | NCK1 |
| UniProt_ID | P16333 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PDGFR1009 |
|---|---|
| Peptide_Sequence | SSVLpYTAVQPNE |
| Peptide_Length | 13 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@H](CO)NC(=O)[C@@H](N)CO)C(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)O)C(C)C)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1404.54 |
|---|---|
| Aliphatic_Index | 82.30769 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 3.07692 |
| Charge_at_pH_7 | -1.00109 |
| Isoelectric_Point | 3.84998 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 21 |
| Number_of_Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 599.34000 |
| X_logP_energy | -7.07430 |
Interaction Information
| Affinity | KD=27 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The phosphotyrosine peptide binding specificity of Nck1 and Nck2 Src homology 2 domains. |
| Release_Year | 2006 |
| PMID | 16636066 |
| DOI | 10.1074/jbc.M512917200 |