PPIRE11297
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | SSSGSTGEIYAAREKTERAERETIQGGDRGLTAPRAEGDTIQGATNRGLAAPQFSLWKRPVVTAYIEGQPVEVLLDTGADDSIVAGIELGNNYSPKIVGGIGGFINTKEYKNVEIEVLNKKVRATIMTGDTPINIFGRNILTALGMSLNL |
| Organism_Source | Human immunodeficiency virus 2 |
| Functional_Classification | proteases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | pol |
| UniProt_ID | Q90066 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | AclCF |
|---|---|
| Peptide_Sequence | CTLNF |
| Peptide_Length | 5 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CS)[C@@H](C)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 596.70 |
|---|---|
| Aliphatic_Index | 78.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.40000 |
| Charge_at_pH_7 | -0.06399 |
| Isoelectric_Point | 5.92254 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 9 |
| Number_of_Hydrogen_Bond_Donors | 9 |
| Topological_Polar_Surface_Area | 243.04000 |
| X_logP_energy | -2.18770 |
Interaction Information
| Affinity | IC50=1000 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Antigen-antibody interactions: elucidation of the epitope and strain-specificity of a monoclonal antibody directed against the pilin protein adherence binding domain of Pseudomonas aeruginosa strain K. |
| Release_Year | 1992 |
| PMID | 1284654 |
| DOI | 10.1002/pro.5560011010 |