PPIRE11343
Target Protein Information
| Protein_Name | Apical membrane antigen 1 |
|---|---|
| Protein_Sequence | CPVFGKGIIIENSKTTFLTPVATENQDLKDGGFAFPPTKPLMSPMTLDHMRDFYKDNEYVKNLDELTLCSRHAGNMNPDNDKNSNYKYPAVYDYNDKKCHILYIAAQENNGPRYCNKDESKRNSMFCFRPAKDISFQNYTYLSKNVVDNWEKVCPRKNLQNAKFGLWVDGNCEDIPHVNEFSANDLFECNKLVFELSASDQPKQYEQHLTDYEKIKEGFKNKNASMIKSAFLPTGAFKADRYKSHGKGYNWGNYNTETHKCEIFNVKPTCLINNSSYIATTALSHPIEVENNFPCSLYKDEIMKEIERESKRIKLNDNDDEGNKKIIAPRIFISDDKDSLKCPCDPEMVSNSTCRFFVCKCVERRAEVTSNNEVVVKEEYKDEYADIPEHKPTYDNMKIIIASSAAVAVLATILMVYLYKRKGNAEKYDKMDEPQHYGKSNSRNDEMLD |
| Organism_Source | Plasmodium falciparum |
| Functional_Classification | membrane proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | AMA1 |
| UniProt_ID | A0A0X8IHV3 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | N*bcRON2hp |
|---|---|
| Peptide_Sequence | XWTTRMSPPMQIp |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCSC)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](CCSC)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CN)[C@@H](C)O)[C@@H](C)O)C(=O)N1CCC[C@H]1C(=O)O |
| Chemical_Modification | X1=MTSL |
| Cyclization_Method | Main chain-main chain cyclization; C1<->p13; other bonds |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1501.78 |
|---|---|
| Aliphatic_Index | 30.00000 |
| Aromaticity | 0.07692 |
| Average_Rotatable_Bonds | 3.23077 |
| Charge_at_pH_7 | 0.99798 |
| Isoelectric_Point | 10.55000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 21 |
| Number_of_Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 567.62000 |
| X_logP_energy | -5.07513 |
Interaction Information
| Affinity | KD=2.2 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | 6N87 |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification of the Binding Site of Apical Membrane Antigen?1 (AMA1)Inhibitors Using a Paramagnetic Probe. |
| Release_Year | 2018 |
| PMID | 30653832 |
| DOI | 10.1002/cmdc.201800802 |