PPIRE11370
Target Protein Information
| Protein_Name | High affinity immunoglobulin gamma Fc receptor I |
|---|---|
| Protein_Sequence | MILTSFGDDMWLLTTLLLWVPVGGEVVNATKAVITLQPPWVSIFQKENVTLWCEGPHLPGDSSTQWFINGTAVQISTPSYSIPEASFQDSGEYRCQIGSSMPSDPVQLQIHNDWLLLQASRRVLTEGEPLALRCHGWKNKLVYNVVFYRNGKSFQFSSDSEVAILKTNLSHSGIYHCSGTGRHRYTSAGVSITVKELFTTPVLRASVSSPFPEGSLVTLNCETNLLLQRPGLQLHFSFYVGSKILEYRNTSSEYHIARAEREDAGFYWCEVATEDSSVLKRSPELELQVLGPQSSAPVWFHILFYLSVGIMFSLNTVLYVKIHRLQREKKYNLEVPLVSEQGKKANSFQQVRSDGVYEEVTATASQTTPKEAPDGPRSSVGDCGPEQPEPLPPSDSTGAQTSQS |
| Organism_Source | Mus musculus |
| Functional_Classification | Fc receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | Fcgr1 |
| UniProt_ID | P26151 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | moRI3 |
|---|---|
| Peptide_Sequence | CVFYRNGKSFQFS |
| Peptide_Length | 13 |
| Peptide_SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(N)=O)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1582.80 |
|---|---|
| Aliphatic_Index | 22.30769 |
| Aromaticity | 0.30769 |
| Average_Rotatable_Bonds | 3.84615 |
| Charge_at_pH_7 | 1.93486 |
| Isoelectric_Point | 9.44787 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 22 |
| Number_of_Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 647.31000 |
| X_logP_energy | -6.37273 |
Interaction Information
| Affinity | IC50=38.03 mM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Analysis of the linear epitope for Fc-binding on the mouse IgG Fc receptor (moFcGammaRI)by synthetic peptide. |
| Release_Year | 2014 |
| PMID | 25036514 |
| DOI | 10.4238/2014.June.18.7 |