PPIRE11688
Target Protein Information
| Protein_Name | WD repeat-containing protein 5 |
|---|---|
| Protein_Sequence | MATEEKKPETEAARAQPTPSSSATQSKPTPVKPNYALKFTLAGHTKAVSSVKFSPNGEWLASSSADKLIKIWGAYDGKFEKTISGHKLGISDVAWSSDSNLLVSASDDKTLKIWDVSSGKCLKTLKGHSNYVFCCNFNPQSNLIVSGSFDESVRIWDVKTGKCLKTLPAHSDPVSAVHFNRDGSLIVSSSYDGLCRIWDTASGQCLKTLIDDDNPPVSFVKFSPNGKYILAATLDNTLKLWDYSKGKCLKTYTGHKNEKYCIFANFSVTGGKWIVSGSEDNLVYIWNLQTKEIVQKLQGHTDVVISTACHPTENIIASAALENDKTIKLWKSDC |
| Organism_Source | Homo sapiens |
| Functional_Classification | WD40 domain-containing proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | WDR5 |
| UniProt_ID | P61964 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | H3R2me0/K4me3 |
|---|---|
| Peptide_Sequence | ARTKQTARKSTGGY |
| Peptide_Length | 14 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)NCC(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | R2=unmodified; K4=trimethylation |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1524.70 |
|---|---|
| Aliphatic_Index | 14.28571 |
| Aromaticity | 0.07143 |
| Average_Rotatable_Bonds | 3.71429 |
| Charge_at_pH_7 | 3.99654 |
| Isoelectric_Point | 11.67668 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 25 |
| Number_of_Hydrogen_Bond_Donors | 29 |
| Topological_Polar_Surface_Area | 761.70000 |
| X_logP_energy | -11.86366 |
Interaction Information
| Affinity | KD=10.9 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural basis for histone mimicry and hijacking of host proteins by influenza virus protein NS1. |
| Release_Year | 2014 |
| PMID | 24853335 |
| DOI | 10.1038/ncomms4952 |