PPIRE11695
Target Protein Information
| Protein_Name | Peroxisome proliferator-activated receptor gamma |
|---|---|
| Protein_Sequence | MGETLGDSPIDPESDSFTDTLSANISQEMTMVDTEMPFWPTNFGISSVDLSVMEDHSHSFDIKPFTTVDFSSISTPHYEDIPFTRTDPVVADYKYDLKLQEYQSAIKVEPASPPYYSEKTQLYNKPHEEPSNSLMAIECRVCGDKASGFHYGVHACEGCKGFFRRTIRLKLIYDRCDLNCRIHKKSRNKCQYCRFQKCLAVGMSHNAIRFGRMPQAEKEKLLAEISSDIDQLNPESADLRALAKHLYDSYIKSFPLTKAKARAILTGKTTDKSPFVIYDMNSLMMGEDKIKFKHITPLQEQSKEVAIRIFQGCQFRSVEAVQEITEYAKSIPGFVNLDLNDQVTLLKYGVHEIIYTMLASLMNKDGVLISEGQGFMTREFLKSLRKPFGDFMEPKFEFAVKFNALELDDSDLAIFIAVIILSGDRPGLLNVKPIEDIQDNLLQALELQLKLNHPESSQLFAKLLQKMTDLRQIVTEHVQLLQVIKKTETDMSLHPLLQEIYKDLY |
| Organism_Source | Homo sapiens |
| Functional_Classification | nuclear receptor |
| Cellular_Localization | Nucleus |
| Gene_Names | PPARG |
| UniProt_ID | P37231 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | PGC-1alpha ID1 motif |
|---|---|
| Peptide_Sequence | AEEPSLLKKLLLAPA |
| Peptide_Length | 15 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)N)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](C)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1592.94 |
|---|---|
| Aliphatic_Index | 150.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.46667 |
| Charge_at_pH_7 | 0.00094 |
| Isoelectric_Point | 6.53076 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 21 |
| Number_of_Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 600.01000 |
| X_logP_energy | -2.53200 |
Interaction Information
| Affinity | IC50=1.7 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | 3CS8 |
| Type | Allosteric modulator |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural and biochemical basis for the binding selectivity of peroxisome proliferator-activated receptor gamma to PGC-1alpha. |
| Release_Year | 2008 |
| PMID | 18469005 |
| DOI | 10.1074/jbc.M802040200 |