PPIRE12019
Target Protein Information
| Protein_Name | Guanine nucleotide-binding protein G(i)subunit alpha-1 |
|---|---|
| Protein_Sequence | MGCTLSAEDKAAVERSKMIDRNLREDGEKAAREVKLLLLGAGESGKSTIVKQMKIIHEAGYSEEECKQYKAVVYSNTIQSIIAIIRAMGRLKIDFGDSARADDARQLFVLAGAAEEGFMTAELAGVIKRLWKDSGVQACFNRSREYQLNDSAAYYLNDLDRIAQPNYIPTQQDVLRTRVKTTGIVETHFTFKDLHFKMFDVGGQRSERKKWIHCFEGVTAIIFCVALSDYDLVLAEDEEMNRMHESMKLFDSICNNKWFTDTSIILFLNKKDLFEEKIKKSPLTICYPEYAGSNTYEEAAAYIQCQFEDLNKRKDTKEIYTHFTCATDTKNVQFVFDAVTDVIIKNNLKDCGLF |
| Organism_Source | Bos taurus |
| Functional_Classification | GTPases |
| Cellular_Localization | Plasma membrane |
| Gene_Names | GNAI1 |
| UniProt_ID | P63097 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | SIRK(G10A) |
|---|---|
| Peptide_Sequence | SIRKALNILAYPDYD |
| Peptide_Length | 15 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](NC(=O)[C@@H](N)CO)[C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1752.00 |
|---|---|
| Aliphatic_Index | 117.33333 |
| Aromaticity | 0.13333 |
| Average_Rotatable_Bonds | 3.66667 |
| Charge_at_pH_7 | -0.00312 |
| Isoelectric_Point | 6.43526 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 24 |
| Number_of_Hydrogen_Bond_Donors | 25 |
| Topological_Polar_Surface_Area | 728.23000 |
| X_logP_energy | -4.97813 |
Interaction Information
| Affinity | IC50=80 uM |
|---|---|
| Affinity_Assay | flow cytometry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural and molecular characterization of a preferred protein interaction surface on G protein beta gamma subunits. |
| Release_Year | 2005 |
| PMID | 16060668 |
| DOI | 10.1021/bi050655i |