PPIRE12241
Target Protein Information
| Protein_Name | Importin subunit alpha-1 |
|---|---|
| Protein_Sequence | MSTNENANLPAARLNRFKNKGKDSTEMRRRRIEVNVELRKAKKDEQMLKRRNVSSFPDDATSPLQENRNNQGTVNWSVEDIVKGINSNNLESQLQATQAARKLLSREKQPPIDNIIRAGLIPKFVSFLGKTDCSPIQFESAWALTNIASGTSEQTKAVVDGGAIPAFISLLASPHAHISEQAVWALGNIAGDGSAFRDLVIKHGAIDPLLALLAVPDLSTLACGYLRNLTWTLSNLCRNKNPAPPLDAVEQILPTLVRLLHHNDPEVLADSCWAISYLTDGPNERIEMVVKKGVVPQLVKLLGATELPIVTPALRAIGNIVTGTDEQTQKVIDAGALAVFPSLLTNPKTNIQKEATWTMSNITAGRQDQIQQVVNHGLVPFLVGVLSKADFKTQKEAAWAITNYTSGGTVEQIVYLVHCGIIEPLMNLLSAKDTKIIQVILDAISNIFQAAEKLGETEKLSIMIEECGGLDKIEALQRHENESVYKASLNLIEKYFSVEEEEDQNVVPETTSEGFAFQVQDGAPGTFNF |
| Organism_Source | Mus musculus |
| Functional_Classification | nuclear transport receptors |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Kpna2 |
| UniProt_ID | P52293 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | pepTM |
|---|---|
| Peptide_Sequence | CGSEFESPFKKKRREA |
| Peptide_Length | 16 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CO)NC(=O)CNC(=O)[C@@H](N)CS)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1899.15 |
|---|---|
| Aliphatic_Index | 6.25000 |
| Aromaticity | 0.12500 |
| Average_Rotatable_Bonds | 4.12500 |
| Charge_at_pH_7 | 1.94044 |
| Isoelectric_Point | 9.57822 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 28 |
| Number_of_Hydrogen_Bond_Donors | 31 |
| Topological_Polar_Surface_Area | 845.25000 |
| X_logP_energy | -9.26446 |
Interaction Information
| Affinity | KD=53.2 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | 3L3Q |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Probing the specificity of binding to the major nuclear localization sequence-binding site of importin-alpha using oriented peptide library screening. |
| Release_Year | 2010 |
| PMID | 20406804 |
| DOI | 10.1074/jbc.M109.079574 |