PPIRE12687
Target Protein Information
| Protein_Name | Suppressor of fused homolog |
|---|---|
| Protein_Sequence | MAELRPSGAPGPTAPPAPGPTAPPAFASLFPPGLHAIYGECRRLYPDQPNPLQVTAIVKYWLGGPDPLDYVSMYRNVGSPSANIPEHWHYISFGLSDLYGDNRVHEFTGTDGPSGFGFELTFRLKRETGESAPPTWPAELMQGLARYVFQSENTFCSGDHVSWHSPLDNSESRIQHMLLTEDPQMQPVQTPFGVVTFLQIVGVCTEELHSAQQWNGQGILELLRTVPIAGGPWLITDMRRGETIFEIDPHLQERVDKGIETDGSNLSGVSAKCAWDDLSRPPEDDEDSRSICIGTQPRRLSGKDTEQIRETLRRGLEINSKPVLPPINPQRQNGLAHDRAPSRKDSLESDSSTAIIPHELIRTRQLESVHLKFNQESGALIPLCLRGRLLHGRHFTYKSITGDMAITFVSTGVEGAFATEEHPYAAHGPWLQILLTEEFVEKMLEDLEDLTSPEEFKLPKEYSWPEKKLKVSILPDVVFDSPLH |
| Organism_Source | Homo sapiens |
| Functional_Classification | Hh pathway regulators |
| Cellular_Localization | Cytoplasm |
| Gene_Names | SUFU |
| UniProt_ID | Q9UMX1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | hGli1(112-128) |
|---|---|
| Peptide_Sequence | SRCTSPGGSYGHLSIGT |
| Peptide_Length | 17 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)CNC(=O)CNC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CO)[C@@H](C)O)C(=O)NCC(=O)N[C@H](C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1679.82 |
|---|---|
| Aliphatic_Index | 45.88235 |
| Aromaticity | 0.05882 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | 1.02606 |
| Isoelectric_Point | 8.53480 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 28 |
| Number_of_Hydrogen_Bond_Donors | 29 |
| Topological_Polar_Surface_Area | 752.32000 |
| X_logP_energy | -12.88293 |
Interaction Information
| Affinity | KD=93.5 nM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural insight into the mutual recognition and regulation between Suppressor of Fused and Gli/Ci. |
| Release_Year | 2013 |
| PMID | 24217340 |
| DOI | 10.1038/ncomms3608 |