PPIRE12814
Target Protein Information
| Protein_Name | Aprataxin and PNK-like factor |
|---|---|
| Protein_Sequence | MSGGFELQPRDGGPRVALAPGETVIGRGPLLGITDKRVSRRHAILEVAGGQLRIKPIHTNPCFYQSSEKSQLLPLKPNLWCYLNPGDSFSLLVDKYIFRILSIPSEVEMQCTLRNSQVLDEDNILNETPKSPVINLPHETTGASQLEGSTEIAKTQMTPTNSVSFLGENRDCNKQQPILAERKRILPTWMLAEHLSDQNLSVPAISGGNVIQGSGKEEICKDKSQLNTTQQGRRQLISSGSSENTSAEQDTGEECKNTDQEESTISSKEMPQSFSAITLSNTEMNNIKTNAQRNKLPIEELGKVSKHKIATKRTPHKEDEAMSCSENCSSAQGDSLQDESQGSHSESSSNPSNPETLHAKATDSVLQGSEGNKVKRTSCMYGANCYRKNPVHFQHFSHPGDSDYGGVQIVGQDETDDRPECPYGPSCYRKNPQHKIEYRHNTLPVRNVLDEDNDNVGQPNEYDLNDSFLDDEEEDYEPTDEDSDWEPGKEDEEKEDVEELLKEAKRFMKRK |
| Organism_Source | Homo sapiens |
| Functional_Classification | forkhead-associated domains |
| Cellular_Localization | Nucleus |
| Gene_Names | APLF |
| UniProt_ID | Q8IW19 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | XRCC1pSpT-18 |
|---|---|
| Peptide_Sequence | DPYAGXXDENTDSEEHQE |
| Peptide_Length | 18 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CC(=O)O)C(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(=O)O)C(=O)O)[C@@H](C)O |
| Chemical_Modification | X6=phosphoserine; X7=phosphothreonine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Fitc-Gly-Gly |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1949.83 |
|---|---|
| Aliphatic_Index | 5.55556 |
| Aromaticity | 0.05556 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | -6.90352 |
| Isoelectric_Point | 3.47031 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 32 |
| Number_of_Hydrogen_Bond_Donors | 31 |
| Topological_Polar_Surface_Area | 985.88000 |
| X_logP_energy | -14.62840 |
Interaction Information
| Affinity | KD=3.31 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Characterization of the APLF FHA-XRCC1 phosphopeptide interaction and its structural and functional implications. |
| Release_Year | 2017 |
| PMID | 29059378 |
| DOI | 10.1093/nar/gkx941 |