PPIRE12851
Target Protein Information
| Protein_Name | Histone chaperone ASF1 |
|---|---|
| Protein_Sequence | MSIVSLLGIKVLNNPAKFTDPYEFEITFECLESLKHDLEWKLTYVGSSRSLDHDQELDSILVGPVPVGVNKFVFSADPPSAELIPASELVSVTVILLSCSYDGREFVRVGYYVNNEYDEEELRENPPAKVQVDHIVRNILAEKPRVTRFNIVWDNENEGDLYPPEQPGVDDEEEEDDEEEDDDEDDEDDEDDDQEDGEGEAEEAAEEEEEEEEKTEDNETNLEEEEEDIENSDGDEEEGEEEVGSVDKNEDGNDKKRRKIEGGSTDIESTPKDAARSTN |
| Organism_Source | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) |
| Functional_Classification | histone chaperone |
| Cellular_Localization | Nucleus |
| Gene_Names | ASF1 |
| UniProt_ID | P32447 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Rtt109419-436 |
|---|---|
| Peptide_Sequence | LAITMLKPRKKAKALPKT |
| Peptide_Length | 18 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](N)CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2008.58 |
|---|---|
| Aliphatic_Index | 103.33333 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.88889 |
| Charge_at_pH_7 | 5.99651 |
| Isoelectric_Point | 12.05455 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 28 |
| Number_of_Hydrogen_Bond_Donors | 27 |
| Topological_Polar_Surface_Area | 772.90000 |
| X_logP_energy | -4.68063 |
Interaction Information
| Affinity | KD=6.91 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 6F0Y |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structural characterization of the Asf1-Rtt109 interaction and its role in histone acetylation. |
| Release_Year | 2017 |
| PMID | 29300933 |
| DOI | 10.1093/nar/gkx1283 |