PPIRE12933
Target Protein Information
| Protein_Name | General transcription factor IIH subunit 1 |
|---|---|
| Protein_Sequence | MATSSEEVLLIVKKVRQKKQDGALYLMAERIAWAPEGKDRFTISHMYADIKCQKISPEGKAKIQLQLVLHAGDTTNFHFSNESTAVKERDAVKDLLQQLLPKFKRKANKELEEKNRMLQEDPVLFQLYKDLVVSQVISAEEFWANRLNVNATDSSSTSNHKQDVGISAAFLADVRPQTDGCNGLRYNLTSDIIESIFRTYPAVKMKYAENVPHNMTEKEFWTRFFQSHYFHRDRLNTGSKDLFAECAKIDEKGLKTMVSLGVKNPLLDLTALEDKPLDEGYGISSVPSASNSKSIKENSNAAIIKRFNHHSAMVLAAGLRKQEAQNEQTSEPSNMDGNSGDADCFQPAVKRAKLQESIEYEDLGKNNSVKTIALNLKKSDRYYHGPTPIQSLQYATSQDIINSFQSIRQEMEAYTPKLTQVLSSSAASSTITALSPGGALMQGGTQQAINQMVPNDIQSELKHLYVAVGELLRHFWSCFPVNTPFLEEKVVKMKSNLERFQVTKLCPFQEKIRRQYLSTNLVSHIEEMLQTAYNKLHTWQSRRLMKKT |
| Organism_Source | Homo sapiens |
| Functional_Classification | general transcription factors |
| Cellular_Localization | Nucleus |
| Gene_Names | GTF2H1 |
| UniProt_ID | P32780 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | DP1 acidic string F403A |
|---|---|
| Peptide_Sequence | DEEDDDDEDEADDEDDDS |
| Peptide_Length | 18 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2087.72 |
|---|---|
| Aliphatic_Index | 5.55556 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.05556 |
| Charge_at_pH_7 | -15.98823 |
| Isoelectric_Point | 2.72079 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 36 |
| Number_of_Hydrogen_Bond_Donors | 36 |
| Topological_Polar_Surface_Area | 1175.05000 |
| X_logP_energy | -16.80220 |
Interaction Information
| Affinity | KD=160.3 uM |
|---|---|
| Affinity_Assay | NMR titration |
| PDB_ID | 5GOW |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The Interaction Mode of the Acidic Region of the Cell Cycle Transcription Factor DP1 with TFIIH. |
| Release_Year | 2016 |
| PMID | 27825926 |
| DOI | 10.1016/j.jmb.2016.11.001 |