PPIRE13039
Target Protein Information
| Protein_Name | Regulation of nuclear pre-mRNA domain-containing protein 1B |
|---|---|
| Protein_Sequence | MSSFSESALEKKLSELSNSQQSVQTLSLWLIHHRKHAGPIVSVWHRELRKAKSNRKLTFLYLANDVIQNSKRKGPEFTREFESVLVDAFSHVAREADEGCKKPLERLLNIWQERSVYGGEFIQQLKLSMEDSKSPPPKATEEKKSLKRTFQQIQEEEDDDYPGSYSPQDPSAGPLLTEELIKALQDLENAASGDATVRQKIASLPQEVQDVSLLEKITDKEAAERLSKTVDEACLLLAEYNGRLAAELEDRRQLARMLVEYTQNQKDVLSEKEKKLEEYKQKLARVTQVRKELKSHIQSLPDLSLLPNVTGGLAPLPSAGDLFSTD |
| Organism_Source | Homo sapiens |
| Functional_Classification | scaffold proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | RPRD1B |
| UniProt_ID | Q9NQG5 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | S2P-K7 CTD |
|---|---|
| Peptide_Sequence | SPKYSPTSPKYSPTSPKYS |
| Peptide_Length | 19 |
| Peptide_SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)CO)[C@@H](C)O)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CO)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2102.33 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.15789 |
| Average_Rotatable_Bonds | 3.05263 |
| Charge_at_pH_7 | 2.99455 |
| Isoelectric_Point | 10.11146 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 34 |
| Number_of_Hydrogen_Bond_Donors | 29 |
| Topological_Polar_Surface_Area | 843.76000 |
| X_logP_energy | -11.39700 |
Interaction Information
| Affinity | KD=8.3 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | RPRD1A and RPRD1B are human RNA polymerase II C-terminal domain scaffolds for Ser5 dephosphorylation. |
| Release_Year | 2014 |
| PMID | 24997600 |
| DOI | 10.1038/nsmb.2853 |