PPIRE13676
Target Protein Information
| Protein_Name | Calcium and integrin-binding protein 1 |
|---|---|
| Protein_Sequence | MGGSGSRLSKELLAEYQDLTFLTKQEILLAHRRFCELLPQEQRSVESSLRAQVPFEQILSLPELKANPFKERICRVFSTSPAKDSLSFEDFLDLLSVFSDTATPDIKSHYAFRIFDFDDDGTLNREDLSRLVNCLTGEGEDTRLSASEMKQLIDNILEESDIDRDGTINLSEFQHVISRSPDFASSFKIVL |
| Organism_Source | Homo sapiens |
| Functional_Classification | EF-hand Ca2+-binding proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | CIB1 |
| UniProt_ID | Q99828 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | alphaIIb cytoplasmic tail peptide |
|---|---|
| Peptide_Sequence | KVGFFKRNRNSPPVNELLEEDQGQ |
| Peptide_Length | 24 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](NC(=O)[C@@H](N)CCCCN)C(C)C)C(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(N)=O)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2802.10 |
|---|---|
| Aliphatic_Index | 56.66667 |
| Aromaticity | 0.08333 |
| Average_Rotatable_Bonds | 3.95833 |
| Charge_at_pH_7 | 0.00316 |
| Isoelectric_Point | 6.64720 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 39 |
| Number_of_Hydrogen_Bond_Donors | 41 |
| Topological_Polar_Surface_Area | 1275.76000 |
| X_logP_energy | -14.28336 |
Interaction Information
| Affinity | KD=12 uM |
|---|---|
| Affinity_Assay | Surface plasmon resonance |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Divalent cations differentially regulate integrin alphaIIb cytoplasmic tail binding to beta3 and to calcium- and integrin-binding protein. |
| Release_Year | 1999 |
| PMID | 10358085 |
| DOI | 10.1074/jbc.274.24.17257 |