PPIRE13692
Target Protein Information
| Protein_Name | NAD-dependent protein deacetylase |
|---|---|
| Protein_Sequence | MKMKEFLDLLNESRLTVTLTGAGISTPSGIPDFRGPNGIYKKYSQNVFDIDFFYSHPEEFYRFAKEGIFPMLQAKPNLAHVLLAKLEEKGLIEAVITQNIDRLHQRAGSKKVIELHGNVEEYYCVRCEKKYTVEDVIKKLESSDVPLCDDCNSLIRPNIVFFGENLPQDALREAIGLSSRASLMIVLGSSLVVYPAAELPLITVRSGGKLVIVNLGETPFDDIATLKYNMDVVEFARRVMEEGGIS |
| Organism_Source | Thermotoga maritima (strain ATCC 43589 / DSM 3109 / JCM 10099 / NBRC 100826 / MSB8) |
| Functional_Classification | deacetylases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | cobB |
| UniProt_ID | Q9WYW0 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | p53 C-terminal peptide |
|---|---|
| Peptide_Sequence | KKGQSTSRHKK |
| Peptide_Length | 11 |
| Peptide_SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1284.48 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.45455 |
| Charge_at_pH_7 | 5.08771 |
| Isoelectric_Point | 11.99738 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 22 |
| Number_of_Hydrogen_Bond_Donors | 24 |
| Topological_Polar_Surface_Area | 652.76000 |
| X_logP_energy | -9.74633 |
Interaction Information
| Affinity | KD=0.799 uM |
|---|---|
| Affinity_Assay | Isothermal titration calorimetry |
| PDB_ID | 3PDH |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of Sir2Tm bound to a propionylated peptide. |
| Release_Year | 2010 |
| PMID | 21080423 |
| DOI | 10.1002/pro.544 |