PPIRE15199
Target Protein Information
| Protein_Name | Proteasome subunit alpha type-7 |
|---|---|
| Protein_Sequence | MSYDRAITVFSPDGHLFQVEYAQEAVKKGSTAVGVRGKDIVVLGVEKKSVAKLQDERTVRKICALDDNVCMAFAGLTADARIVINRARVECQSHRLTVEDPVTVEYITRYIASLKQRYTQSNGRRPFGISALIVGFDFDGTPRLYQTDPSGTYHAWKANAIGRGAKSVREFLEKNYTDDAIETDDLTIKLVIKALLEVVQSGGKNIELAVMRRDQPLKILNPEEIEKYVAEIEKEKEENEKKKQKKAS |
| Organism_Source | Mus musculus |
| Functional_Classification | proteasome |
| Cellular_Localization | Cytoplasm |
| Gene_Names | Psma7 |
| UniProt_ID | Q9Z2U0 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | HBx-116-138 |
|---|---|
| Peptide_Sequence | LFKDWEELGEEIRLKVFVLGGCR |
| Peptide_Length | 23 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](CS)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O)C(C)C)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2737.21 |
|---|---|
| Aliphatic_Index | 110.00000 |
| Aromaticity | 0.13043 |
| Average_Rotatable_Bonds | 4.08696 |
| Charge_at_pH_7 | -1.05704 |
| Isoelectric_Point | 4.70693 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 34 |
| Number_of_Hydrogen_Bond_Donors | 39 |
| Topological_Polar_Surface_Area | 1081.65000 |
| X_logP_energy | -4.64176 |
Interaction Information
| Affinity | IC50=1 uM |
|---|---|
| Affinity_Assay | Enzyme Inhibition Kinetics |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Hepatitis B virus HBx peptide 116-138 and proteasome activator PA28 compete for binding to the proteasome alpha4/MC6 subunit |
| Release_Year | 2003 |
| PMID | 12674498 |
| DOI | 10.1515/BC.2003.005 |