PPIRE15246
Target Protein Information
| Protein_Name | Heterochromatin protein 1 |
|---|---|
| Protein_Sequence | MGKKIDNPESSAKVSDAEEEEEEYAVEKIIDRRVRKGKVEYYLKWKGYPETENTWEPENNLDCQDLIQQYEASRKDEEKSAASKKDRPSSSAKAKETQGRASSSTSTASKRKSEEPTAPSGNKSKRTTDAEQDTIPVSGSTGFDRGLEAEKILGASDNNGRLTFLIQFKGVDQAEMVPSSVANEKIPRMVIHFYEERLSWYSDNED |
| Organism_Source | Drosophila melanogaster |
| Functional_Classification | heterochromatin protein |
| Cellular_Localization | Nucleus |
| Gene_Names | Su(var)205 |
| UniProt_ID | P05205 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | HP2 peptide |
|---|---|
| Peptide_Sequence | QNISPRKLCVKINRRPYNKWLR |
| Peptide_Length | 22 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@@H](NC(=O)[C@H](CS)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](N)CCC(N)=O)[C@@H](C)CC)C(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2783.34 |
|---|---|
| Aliphatic_Index | 84.09091 |
| Aromaticity | 0.09091 |
| Average_Rotatable_Bonds | 4.22727 |
| Charge_at_pH_7 | 6.93426 |
| Isoelectric_Point | 12.10661 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 37 |
| Number_of_Hydrogen_Bond_Donors | 44 |
| Topological_Polar_Surface_Area | 1211.11000 |
| X_logP_energy | -10.64192 |
Interaction Information
| Affinity | KD=0.3 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The HP1a Disordered C Terminus and Chromo Shadow Domain Cooperate to Select Target Peptide Partners |
| Release_Year | 2011 |
| PMID | 21472955 |
| DOI | 10.1002/cbic.201000598 |