PPIRE15313
Target Protein Information
| Protein_Name | Claudin-18 |
|---|---|
| Protein_Sequence | MSTTTCQVVAFLLSILGLAGCIAATGMDMWSTQDLYDNPVTSVFQYEGLWRSCVRQSSGFTECRPYFTILGLPAMLQAVRALMIVGIVLGAIGLLVSIFALKCIRIGSMEDSAKANMTLTSGIMFIVSGLCAIAGVSVFANMLVTNFWMSTANMYTGMGGMVQTVQTRYTFGAALFVGWVAGGLTLIGGVMMCIACRGLAPEETNYKAVSYHASGHSVAYKPGGFKASTGFGSNTKNKKIYDGGARTEDEVQSYPSKHDYV |
| Organism_Source | Homo sapiens |
| Functional_Classification | tight junction proteins |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CLDN18 |
| UniProt_ID | P56856 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide 3b |
|---|---|
| Peptide_Sequence | ACHYGYPGRCG |
| Peptide_Length | 11 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CS)C(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; C2<-->C10; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Biotin-Ttds |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1183.32 |
|---|---|
| Aliphatic_Index | 9.09091 |
| Aromaticity | 0.18182 |
| Average_Rotatable_Bonds | 2.90909 |
| Charge_at_pH_7 | 0.96324 |
| Isoelectric_Point | 8.22620 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 18 |
| Number_of_Hydrogen_Bond_Donors | 19 |
| Topological_Polar_Surface_Area | 476.57000 |
| X_logP_energy | -5.34813 |
Interaction Information
| Affinity | IC50=0.57 nM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Peptide microarrays enable rapid mimotope optimization for pharmacokinetic analysis of the novel therapeutic antibody IMAB362 |
| Release_Year | 2014 |
| PMID | 24497417 |
| DOI | 10.1002/biot.201300456 |