PPIRE15380
Target Protein Information
| Protein_Name | Alpha-1-acid glycoprotein 1 |
|---|---|
| Protein_Sequence | MALSWVLTVLSLLPLLEAQIPLCANLVPVPITNATLDRITGKWFYIASAFRNEEYNKSVQEIQATFFYFTPNKTEDTIFLREYQTRQDQCIYNTTYLNVQRENGTISRYVGGQEHFAHLLILRDTKTYMLAFDVNDEKNWGLSVYADKPETTKEQLGEFYEALDCLRIPKSDVVYTDWKKDKCEPLEKQHEKERKQEEGES |
| Organism_Source | Homo sapiens |
| Functional_Classification | Lipocalins |
| Cellular_Localization | Extracellular |
| Gene_Names | ORM1 |
| UniProt_ID | P02763 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | CAP 5 |
|---|---|
| Peptide_Sequence | RXR |
| Peptide_Length | 3 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)CNC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| Chemical_Modification | X2=diphenylalanine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | benzyl |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 387.44 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 4.33333 |
| Charge_at_pH_7 | 1.99798 |
| Isoelectric_Point | 12.50011 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 6 |
| Number_of_Hydrogen_Bond_Donors | 10 |
| Topological_Polar_Surface_Area | 245.32000 |
| X_logP_energy | -3.47416 |
Interaction Information
| Affinity | KD=47.3 mM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Short cationic antimicrobial peptides bind to human alpha-1 acid glycoprotein with no implications for the in vitro bioactivity |
| Release_Year | 2013 |
| PMID | 23996488 |
| DOI | 10.1002/jmr.2288 |