PPIRE15583
Target Protein Information
| Protein_Name | Programmed cell death protein 1 |
|---|---|
| Protein_Sequence | MQIPQAPWPVVWAVLQLGWRPGWFLDSPDRPWNPPTFSPALLVVTEGDNATFTCSFSNTSESFVLNWYRMSPSNQTDKLAAFPEDRSQPGQDCRFRVTQLPNGRDFHMSVVRARRNDSGTYLCGAISLAPKAQIKESLRAELRVTERRAEVPTAHPSPSPRPAGQFQTLVVGVVGGLLGSLVLLVWVLAVICSRAARGTIGARRTGQPLKEDPSAVPVFSVDYGELDFQWREKTPEPPVPCVPEQTEYATIVFPSGMGTSSPARRGSADGPRSAQPLRPEDGHCSWPL |
| Organism_Source | Homo sapiens |
| Functional_Classification | immune checkpoint receptors |
| Cellular_Localization | Plasma membrane |
| Gene_Names | PDCD1 |
| UniProt_ID | Q15116 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | DS-II[c11127] |
|---|---|
| Peptide_Sequence | CYRCMISYGGADYKRIC |
| Peptide_Length | 17 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](C)NC(=O)CNC(=O)CNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)CS)[C@@H](C)CC)C(=O)N[C@@H](CS)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | Side chain-side chain cyclization; C1<-->C17; disulfide bond |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2002.37 |
|---|---|
| Aliphatic_Index | 51.76471 |
| Aromaticity | 0.17647 |
| Average_Rotatable_Bonds | 3.76471 |
| Charge_at_pH_7 | 1.80965 |
| Isoelectric_Point | 8.49136 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 30 |
| Number_of_Hydrogen_Bond_Donors | 33 |
| Topological_Polar_Surface_Area | 796.96000 |
| X_logP_energy | -6.96006 |
Interaction Information
| Affinity | KD=17.5 uM |
|---|---|
| Affinity_Assay | Fluorescence Polarization |
| PDB_ID | 4ZQK |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure-based derivation and intramolecular cyclization of peptide inhibitors from PD-1/PD-L1 complex interface as immune checkpoint blockade for breast cancer immunotherapy |
| Release_Year | 2019 |
| PMID | 31276987 |
| DOI | 10.1016/j.bpc.2019.106213 |