PPIRE15599
Target Protein Information
| Protein_Name | WW domain-binding protein 4 |
|---|---|
| Protein_Sequence | MADYWKSQPKKFCDYCKCWIADNRPSVEFHERGKNHKENVAKRISEIKQKSLDKAKEEEKASKEFAAMEAAALKAYQEDLKRLGLESEILEPSITPVTSTIPPTSTSNQQKEKKEKKKRKKDPSKGRWVEGITSEGYHYYYDLISGASQWEKPEGFQGDLKKTAVKTVWVEGLSEDGFTYYYNTETGESRWEKPDDFIPHTSDLPSSKVNENSLGTLDESKSSDSHSDSDGEQEAEEGGVSTETEKPKIKFKEKNKNSDGGSDPETQKEKSIQKQNSLGSNEEKSKTLKKSNPYGEWQEIKQEVESHEEVDLELPSTENEYVSTSEADGGGEPKVVFKEKTVTSLGVMADGVAPVFKKRRTENGKSRNLRQRGDDQ |
| Organism_Source | Homo sapiens |
| Functional_Classification | WW domain proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | WBP4 |
| UniProt_ID | O75554 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | hPG-2 |
|---|---|
| Peptide_Sequence | CGPPPRGPPPR |
| Peptide_Length | 11 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@@H](N)CS)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1130.33 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.18182 |
| Charge_at_pH_7 | 1.93600 |
| Isoelectric_Point | 10.52641 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 15 |
| Number_of_Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 425.38000 |
| X_logP_energy | -4.99736 |
Interaction Information
| Affinity | KD=5 uM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Peptideolymer ligands for a tandem WW-domain an adaptive multivalent proteinrotein interaction: lessons on the thermodynamic fitness of flexible ligands |
| Release_Year | 2015 |
| PMID | 26124884 |
| DOI | 10.3762/bjoc.11.93 |