PPIRE15725
Target Protein Information
| Protein_Name | Protein TonB |
|---|---|
| Protein_Sequence | MTLDLPRRFPWPTLLSVCIHGAVVAGLLYTSVHQVIELPAPAQPISVTMVTPADLEPPQAVQPPPEPVVEPEPEPEPIPEPPKEAPVVIEKPKPKPKPKPKPVKKVQEQPKRDVKPVESRPASPFENTAPARLTSSTATAATSKPVTSVASGPRALSRNQPQYPARAQALRIEGQVKVKFDVTPDGRVDNVQILSAKPANMFEREVKNAMRRWRYEPGKPGSGIVVNILFKINGTTEIQ |
| Organism_Source | Escherichia coli (strain K12) |
| Functional_Classification | Energy transducers TonB dependent transport |
| Cellular_Localization | Plasma membrane |
| Gene_Names | tonB |
| UniProt_ID | P02929 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | FhuA TonB box peptide |
|---|---|
| Peptide_Sequence | EDTITVTAAP |
| Peptide_Length | 10 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)[C@@H](C)O)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O)[C@@H](C)O)C(C)C)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1017.10 |
|---|---|
| Aliphatic_Index | 88.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 2.90000 |
| Charge_at_pH_7 | -1.99979 |
| Isoelectric_Point | 3.55007 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 16 |
| Number_of_Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 451.72000 |
| X_logP_energy | -5.50850 |
Interaction Information
| Affinity | KD=36 mM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | The Solution Structure of the C-terminal Domain of TonB and Interaction Studies with TonB Box Peptides |
| Release_Year | 2005 |
| PMID | 15644214 |
| DOI | 10.1016/j.jmb.2004.11.026 |