PPIRE16017
Target Protein Information
| Protein_Name | Dipeptide-binding protein |
|---|---|
| Protein_Sequence | MRISLKKSGMLKLGLSLVAMTVAASVQAKTLVYCSEGSPEGFNPQLFTSGTTYDASSVPLYNRLVEFKIGTTEVIPGLAEKWEVSEDGKTYTFHLRKGVKWHDNKEFKPTRELNADDVVFSFDRQKNAQNPYHKVSGGSYEYFEGMGLPELISEVKKVDDNTVQFVLTRPEAPFLADLAMDFASILSKEYADAMMKAGTPEKLDLNPIGTGPFQLQQYQKDSRIRYKAFDGYWGTKPQIDTLVFSITPDASVRYAKLQKNECQVMPYPNPADIARMKQDKSINLMEMPGLNVGYLSYNVQKKPLDDVKVRQALTYAVNKDAIIKAVYQGAGVSAKNLIPPTMWGYNDDVQDYTYDPEKAKALLKEAGLEKGFSIDLWAMPVQRPYNPNARRMAEMIQADWAKVGVQAKIVTYEWGEYLKRAKDGEHQTVMMGWTGDNGDPDNFFATLFSCAASEQGSNYSKWCYKPFEDLIQPARATDDHNKRVELYKQAQVVMHDQAPALIIAHSTVFEPVRKEVKGYVVDPLGKHHFENVSIE |
| Organism_Source | Escherichia coli (strain K12) |
| Functional_Classification | ATP-binding cassette (ABC) transporter substrate-binding protein (SBP) |
| Cellular_Localization | Extracellular |
| Gene_Names | dppA |
| UniProt_ID | P23847 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Ala-u-Glu-Phe-Leu |
|---|---|
| Peptide_Sequence | AEFL |
| Peptide_Length | 4 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](C)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 478.55 |
|---|---|
| Aliphatic_Index | 122.50000 |
| Aromaticity | 0.25000 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | -1.00024 |
| Isoelectric_Point | 3.84998 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 6 |
| Number_of_Hydrogen_Bond_Donors | 6 |
| Topological_Polar_Surface_Area | 187.92000 |
| X_logP_energy | 0.02620 |
Interaction Information
| Affinity | KD=110 uM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Substrate |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Mutant variants of the substrate-binding protein DppA from Escherichia coli enhance growth on non-standard u-glutamyl amide-containing peptides |
| Release_Year | 2018 |
| PMID | 29728377 |
| DOI | 10.1128/AEM.00340-18 |