PPIRE16045
Target Protein Information
| Protein_Name | Programmed cell death protein 1 |
|---|---|
| Protein_Sequence | MQIPQAPWPVVWAVLQLGWRPGWFLDSPDRPWNPPTFSPALLVVTEGDNATFTCSFSNTSESFVLNWYRMSPSNQTDKLAAFPEDRSQPGQDCRFRVTQLPNGRDFHMSVVRARRNDSGTYLCGAISLAPKAQIKESLRAELRVTERRAEVPTAHPSPSPRPAGQFQTLVVGVVGGLLGSLVLLVWVLAVICSRAARGTIGARRTGQPLKEDPSAVPVFSVDYGELDFQWREKTPEPPVPCVPEQTEYATIVFPSGMGTSSPARRGSADGPRSAQPLRPEDGHCSWPL |
| Organism_Source | Homo sapiens |
| Functional_Classification | immune checkpoint receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | PDCD1 |
| UniProt_ID | Q15116 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | WANG-004 |
|---|---|
| Peptide_Sequence | FRWWR |
| Peptide_Length | 5 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| Chemical_Modification | |
| Cyclization_Method | |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 849.99 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.60000 |
| Average_Rotatable_Bonds | 4.60000 |
| Charge_at_pH_7 | 1.99798 |
| Isoelectric_Point | 12.50011 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 8 |
| Number_of_Hydrogen_Bond_Donors | 14 |
| Topological_Polar_Surface_Area | 335.10000 |
| X_logP_energy | 0.55474 |
Interaction Information
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | PD-1-Targeted Discovery of Peptide Inhibitors by Virtual Screening Molecular Dynamics Simulation and Surface Plasmon Resonance |
| Release_Year | 2019 |
| PMID | 31640203 |
| DOI | 10.3390/molecules24203784 |