PPIRE16173
Target Protein Information
| Protein_Name | Nuclear protein 1 |
|---|---|
| Protein_Sequence | MATFPPATSAPQQPPGPEDEDSSLDESDLYSLAHSYLGGGGRKGRTKREAAANTNRPSPGGHERKLVTKLQNSERKKRGARR |
| Organism_Source | Homo sapiens |
| Functional_Classification | intrinsically disordered proteins |
| Cellular_Localization | Nucleus |
| Gene_Names | NUPR1 |
| UniProt_ID | O60356 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | P-2 |
|---|---|
| Peptide_Sequence | VKNWMTEYLLVQ |
| Peptide_Length | 12 |
| Peptide_SMILES | CSCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)O)C(C)C)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Acetyl |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1523.81 |
|---|---|
| Aliphatic_Index | 113.33333 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 4.08333 |
| Charge_at_pH_7 | -0.00139 |
| Isoelectric_Point | 6.40200 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 20 |
| Number_of_Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 589.17000 |
| X_logP_energy | -1.92380 |
Interaction Information
| Affinity | KD=0.57 uM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Amphipathic helical peptides hamper protein-protein interactions of the intrinsically disordered chromatin nuclear protein 1 (NUPR1) |
| Release_Year | 2018 |
| PMID | 29530795 |
| DOI | 10.1016/j.bbagen.2018.03.009 |