PPIRE16354
Target Protein Information
| Protein_Name | Beta sliding clamp |
|---|---|
| Protein_Sequence | MKFTVEREHLLKPLQQVSGPLGGRPTLPILGNLLLQVADGTLSLTGTDLEMEMVARVALVQPHEPGATTVPARKFFDICRGLPEGAEIAVQLEGERMLVRSGRSRFSLSTLPAADFPNLDDWQSEVEFTLPQATMKRLIEATQFSMAHQDVRYYLNGMLFETEGEELRTVATDGHRLAVCSMPIGQSLPSHSVIVPRKGVIELMRMLDGGDNPLRVQIGSNNIRAHVGDFIFTSKLVDGRFPDYRRVLPKNPDKHLEAGCDLLKQAFARAAILSNEKFRGVRLYVSENQLKITANNPEQEEAEEILDVTYSGAEMEIGFNVSYVLDVLNALKCENVRMMLTDSVSSVQIEDAASQSAAYVVMPMRL |
| Organism_Source | Escherichia coli (strain K12) |
| Functional_Classification | sliding clamp |
| Cellular_Localization | Cytoplasm |
| Gene_Names | dnaN |
| UniProt_ID | P0A988 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | consensus-2 |
|---|---|
| Peptide_Sequence | IGQLSLFGV |
| Peptide_Length | 9 |
| Peptide_SMILES | CC[C@H](C)[C@H](N)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)N[C@H](C(=O)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 933.12 |
|---|---|
| Aliphatic_Index | 162.22222 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 3.33333 |
| Charge_at_pH_7 | -0.00202 |
| Isoelectric_Point | 6.10000 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 12 |
| Number_of_Hydrogen_Bond_Donors | 12 |
| Topological_Polar_Surface_Area | 359.44000 |
| X_logP_energy | -2.16570 |
Interaction Information
| Affinity | KD=0.8 uM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Inhibition of Protein Interactions with the u2 Sliding Clamp of Escherichia coli DNA Polymerase III by Peptides from u2-Binding Proteins |
| Release_Year | 2004 |
| PMID | 15134440 |
| DOI | 10.1021/bi036229j |