PPIRE16476
Target Protein Information
| Protein_Name | Hemagglutinin |
|---|---|
| Protein_Sequence | KTDTTTSVATEDINRTFKPLIGPRPLVNGQQGRIDYYWSVLKPGQTLRVRSNGNLIAPWYGHILSGESHGRILKTDLNSGNCVVQCQTERGGLNTTLPFHNVSKYAFGNCPKYVGVKSLKLAVGLRNVAARSSRGLF |
| Organism_Source | Influenza A virus |
| Functional_Classification | glycoproteins |
| Cellular_Localization | Extracellular |
| Gene_Names | HA |
| UniProt_ID | Q99I05 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | L-P1 |
|---|---|
| Peptide_Sequence | NDFRSKT |
| Peptide_Length | 7 |
| Peptide_SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CO)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CC(N)=O)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 866.93 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.14286 |
| Average_Rotatable_Bonds | 4.14286 |
| Charge_at_pH_7 | 0.99813 |
| Isoelectric_Point | 9.69502 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 14 |
| Number_of_Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 446.69000 |
| X_logP_energy | -6.33473 |
Interaction Information
| Affinity | IC50=71 uM |
|---|---|
| Affinity_Assay | virus yield reduction assay in ovo |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Identification and characterisation of a novel anti-viral peptide against avian influenza virus H9N2 |
| Release_Year | 2009 |
| PMID | 19497129 |
| DOI | 10.1186/1743-422X-6-74 |