PPIRE16532
Target Protein Information
| Protein_Name | T cell receptor alpha variable 22/ |
|---|---|
| Protein_Sequence | MKRILGALLGLLSAQVCCVRGIQVEQSPPDLILQEGANSTLRCNFSDSVNNLQWFHQNPWGQLINLFYIPSGTKQNGRLSATTVATERYSLLYISSSQTTDSGVYFCAVE/ |
| Organism_Source | Homo sapiens/ |
| Functional_Classification | T cell receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | TRAV22/ |
| UniProt_ID | A0A0B4J277/A0A578.1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | MBP8901 |
|---|---|
| Peptide_Sequence | VHFFKNIVTPRTP |
| Peptide_Length | 13 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)O)[C@@H](C)O)[C@@H](C)O)C(C)C |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1555.84 |
|---|---|
| Aliphatic_Index | 74.61538 |
| Aromaticity | 0.15385 |
| Average_Rotatable_Bonds | 3.46154 |
| Charge_at_pH_7 | 2.08860 |
| Isoelectric_Point | 11.65179 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 20 |
| Number_of_Hydrogen_Bond_Donors | 20 |
| Topological_Polar_Surface_Area | 595.09000 |
| X_logP_energy | -3.93313 |
Interaction Information
| Affinity | EC50=30 nM |
|---|---|
| Affinity_Assay | T-cell proliferation assay |
| PDB_ID | 1ZGL |
| Type | Agonist |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Structure of a human autoimmune TCR bound to a myelin basic protein self-peptide and a multiple sclerosis-associated MHC class II molecule |
| Release_Year | 2005 |
| PMID | 16079912 |
| DOI | 10.1038/sj.emboj.7600771 |