PPIRE16555
Target Protein Information
| Protein_Name | HSPA8-interacting micropeptide miPEP155 |
|---|---|
| Protein_Sequence | MEMALMVAQTRKGKSVV |
| Organism_Source | Homo sapiens |
| Functional_Classification | ATPases |
| Cellular_Localization | Cytoplasm |
| Gene_Names | MIR155HG |
| UniProt_ID | C0HMA1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide24 |
|---|---|
| Peptide_Sequence | GLLELDIPIDMSKALKKTLLN |
| Peptide_Length | 21 |
| Peptide_SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)CN)[C@@H](C)CC)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2325.83 |
|---|---|
| Aliphatic_Index | 153.33333 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 3.90476 |
| Charge_at_pH_7 | -0.00023 |
| Isoelectric_Point | 6.55292 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 32 |
| Number_of_Hydrogen_Bond_Donors | 30 |
| Topological_Polar_Surface_Area | 910.04000 |
| X_logP_energy | -5.17660 |
Interaction Information
| Affinity | EC50=44 uM |
|---|---|
| Affinity_Assay | Colorimetric binding assay |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Short peptides derived from the BAG-1 C-terminus inhibit the interaction between BAG-1 and HSC70 and decrease breast cancer cell growth |
| Release_Year | 2009 |
| PMID | 19800331 |
| DOI | 10.1016/j.febslet.2009.09.047 |