PPIRE16727
Target Protein Information
| Protein_Name | Metallo-beta-lactamase domain-containing protein |
|---|---|
| Protein_Sequence | MFKQIPLGPIQTNAYVLYNDDKEAVIFDPGGDAEALITWLKREQLTPLAILLTHAHFDHIGAVDAVRDTFSIPVYLHTKERHWLEDPALNGSSRLTGRPITTAKPADHLLTNEKSLTIGTFTFSVFHTPGHSPGSVSYYYQKEAVLFSGDVLFQQSIGRTDLRGGDHTLLLASIHNKILPLPERTIVASGHGPLTTIGQEMDHNPFLTGY |
| Organism_Source | Shouchella lehensis G1 |
| Functional_Classification | metallo u lactamase |
| Cellular_Localization | Extracellular |
| Gene_Names | None |
| UniProt_ID | A0A060M4R1 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | RSWPWH |
|---|---|
| Peptide_Sequence | RSWPWH |
| Peptide_Length | 6 |
| Peptide_SMILES | N=C(N)NCCC[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 867.97 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.33333 |
| Average_Rotatable_Bonds | 3.50000 |
| Charge_at_pH_7 | 1.08889 |
| Isoelectric_Point | 10.55176 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 10 |
| Number_of_Hydrogen_Bond_Donors | 13 |
| Topological_Polar_Surface_Area | 342.42000 |
| X_logP_energy | -1.00213 |
Interaction Information
| Affinity | KD=497 nM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Design and Characterisation of Inhibitory Peptides against Bleg1_2478 an Evolutionary Divergent B3 Metallo-u-lactamase |
| Release_Year | 2020 |
| PMID | 33316879 |
| DOI | 10.3390/molecules25245797 |