PPIRE16960
Target Protein Information
| Protein_Name | T-cell surface glycoprotein CD4 |
|---|---|
| Protein_Sequence | MNRGVPFRHLLLVLQLALLPAATQGKKVVLGKKGDTVELTCTASQKKSIQFHWKNSNQIKILGNQGSFLTKGPSKLNDRADSRRSLWDQGNFPLIIKNLKIEDSDTYICEVEDQKEEVQLLVFGLTANSDTHLLQGQSLTLTLESPPGSSPSVQCRSPRGKNIQGGKTLSVSQLELQDSGTWTCTVLQNQKKVEFKIDIVVLAFQKASSIVYKKEGEQVEFSFPLAFTVEKLTGSGELWWQAERASSSKSWITFDLKNKEVSVKRVTQDPKLQMGKKLPLHLTLPQALPQYAGSGNLTLALEAKTGKLHQEVNLVVMRATQLQKNLTCEVWGPTSPKLMLSLKLENKEAKVSKREKAVWVLNPEAGMWQCLLSDSGQVLLESNIKVLPTWSTPVQPMALIVLGGVAGLLLFIGLGIFFCVRCRHRRRQAERMSQIKRLLSEKKTCQCPHRFQKTCSPI |
| Organism_Source | Homo sapiens |
| Functional_Classification | immunoglobulin superfamily |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CD4 |
| UniProt_ID | P01730 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | T22 |
|---|---|
| Peptide_Sequence | RRWCYRKSYKGYCYRKCR |
| Peptide_Length | 18 |
| Peptide_SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CS)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CS)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CO)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](CS)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CCCNC(=N)N)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2475.94 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.27778 |
| Average_Rotatable_Bonds | 4.50000 |
| Charge_at_pH_7 | 7.80776 |
| Isoelectric_Point | 10.53604 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 35 |
| Number_of_Hydrogen_Bond_Donors | 46 |
| Topological_Polar_Surface_Area | 1062.52000 |
| X_logP_energy | -8.72645 |
Interaction Information
| Affinity | KD=101 nM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Analysis of the interaction of an anti-HIV peptide T22 ([Tyr5-12 Lys7]-polyphemusin II) with gp120 and CD4 by surface plasmon resonance |
| Release_Year | 1996 |
| PMID | 8948487 |
| DOI | 10.1016/S0167-4838(96)00113-6 |