PPIRE17025
Target Protein Information
| Protein_Name | T-cell surface glycoprotein CD4 |
|---|---|
| Protein_Sequence | MNRGVPFRHLLLVLQLALLPAATQGKKVVLGKKGDTVELTCTASQKKSIQFHWKNSNQIKILGNQGSFLTKGPSKLNDRADSRRSLWDQGNFPLIIKNLKIEDSDTYICEVEDQKEEVQLLVFGLTANSDTHLLQGQSLTLTLESPPGSSPSVQCRSPRGKNIQGGKTLSVSQLELQDSGTWTCTVLQNQKKVEFKIDIVVLAFQKASSIVYKKEGEQVEFSFPLAFTVEKLTGSGELWWQAERASSSKSWITFDLKNKEVSVKRVTQDPKLQMGKKLPLHLTLPQALPQYAGSGNLTLALEAKTGKLHQEVNLVVMRATQLQKNLTCEVWGPTSPKLMLSLKLENKEAKVSKREKAVWVLNPEAGMWQCLLSDSGQVLLESNIKVLPTWSTPVQPMALIVLGGVAGLLLFIGLGIFFCVRCRHRRRQAERMSQIKRLLSEKKTCQCPHRFQKTCSPI |
| Organism_Source | Homo sapiens |
| Functional_Classification | immune co receptor |
| Cellular_Localization | Plasma membrane |
| Gene_Names | CD4 |
| UniProt_ID | P01730 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Peptide T |
|---|---|
| Peptide_Sequence | aSTTTNYT |
| Peptide_Length | 8 |
| Peptide_SMILES | C[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O)[C@@H](C)O |
| Chemical_Modification | a1=D-alanine |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 857.87 |
|---|---|
| Aliphatic_Index | 12.50000 |
| Aromaticity | 0.12500 |
| Average_Rotatable_Bonds | 3.00000 |
| Charge_at_pH_7 | -0.00287 |
| Isoelectric_Point | 6.09320 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 16 |
| Number_of_Hydrogen_Bond_Donors | 16 |
| Topological_Polar_Surface_Area | 431.49000 |
| X_logP_energy | -7.84900 |
Interaction Information
| Affinity | KD=56 nM |
|---|---|
| Affinity_Assay | Surface Plasmon Resonance |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Verification of the interaction between peptide T and CD4 using surface plasmon resonance |
| Release_Year | 1993 |
| PMID | 8224182 |
| DOI | 10.1016/0014-5793(93)80657-g |