PPIRE17163
Target Protein Information
| Protein_Name | None |
|---|---|
| Protein_Sequence | LPLRTFRVFRALKAISVVS |
| Organism_Source | Homo sapiens |
| Functional_Classification | biotin-binding proteins |
| Cellular_Localization | Extracellular |
| Gene_Names | SCN11A |
| UniProt_ID | Q9UKU5 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | Strep-tag |
|---|---|
| Peptide_Sequence | SAWRHPQFGG |
| Peptide_Length | 10 |
| Peptide_SMILES | C[C@H](NC(=O)[C@@H](N)CO)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc1c[nH]cn1)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)NCC(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 1142.24 |
|---|---|
| Aliphatic_Index | 10.00000 |
| Aromaticity | 0.20000 |
| Average_Rotatable_Bonds | 3.20000 |
| Charge_at_pH_7 | 1.08889 |
| Isoelectric_Point | 10.55176 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 15 |
| Number_of_Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 486.12000 |
| X_logP_energy | -4.99603 |
Interaction Information
| Affinity | KD=37 uM |
|---|---|
| Affinity_Assay | ELISA |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Mutagenesis of a flexible loop in streptavidin leads to higher affinity for the Strep-tag II peptide and improved performance in recombinant protein purification |
| Release_Year | 1997 |
| PMID | 9415448 |
| DOI | 10.1093/protein/10.8.975 |