PPIRE17251
Target Protein Information
| Protein_Name | Growth factor receptor-bound protein 7 |
|---|---|
| Protein_Sequence | MELDLSPPHLSSSPEDLCPAPGTPPGTPRPPDTPLPEEVKRSQPLLIPTTGRKLREEERRATSLPSIPNPFPELCSPPSQSPILGGPSSARGLLPRDASRPHVVKVYSEDGACRSVEVAAGATARHVCEMLVQRAHALSDETWGLVECHPHLALERGLEDHESVVEVQAAWPVGGDSRFVFRKNFAKYELFKSSPHSLFPEKMVSSCLDAHTGISHEDLIQNFLNAGSFPEIQGFLQLRGSGRKLWKRFFCFLRRSGLYYSTKGTSKDPRHLQYVADVNESNVYVVTQGRKLYGMPTDFGFCVKPNKLRNGHKGLRIFCSEDEQSRTCWLAAFRLFKYGVQLYKNYQQAQSRHLHPSCLGSPPLRSASDNTLVAMDFSGHAGRVIENPREALSVALEEAQAWRKKTNHRLSLPMPASGTSLSAAIHRTQLWFHGRISREESQRLIGQQGLVDGLFLVRESQRNPQGFVLSLCHLQKVKHYLILPSEEEGRLYFSMDDGQTRFTDLLQLVEFHQLNRGILPCLLRHCCTRVAL |
| Organism_Source | Homo sapiens |
| Functional_Classification | SH2 domain containing proteins |
| Cellular_Localization | Cytoplasm |
| Gene_Names | GRB7 |
| UniProt_ID | Q14451 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | G7-B7 |
|---|---|
| Peptide_Sequence | CDNAYNATC |
| Peptide_Length | 9 |
| Peptide_SMILES | C[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](C)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CS)C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)O)[C@@H](C)O |
| Chemical_Modification | None |
| Cyclization_Method | side chainide chain cyclization; D2<-->K8; other bonds |
| Linear/Cyclic | Cyclic |
| N-terminal_Modification | Free |
| C-terminal_Modification | Amide |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 974.03 |
|---|---|
| Aliphatic_Index | 22.22222 |
| Aromaticity | 0.11111 |
| Average_Rotatable_Bonds | 3.11111 |
| Charge_at_pH_7 | -1.12637 |
| Isoelectric_Point | 3.74996 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 17 |
| Number_of_Hydrogen_Bond_Donors | 17 |
| Topological_Polar_Surface_Area | 460.06000 |
| X_logP_energy | -7.26930 |
Interaction Information
| Affinity | KD=1.1 uM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Evaluation of Cyclic Peptide Inhibitors of the Grb7 Breast Cancer Target: Small Change in Cargo Results in Large Change in Cellular Activity |
| Release_Year | 2019 |
| PMID | 31627265 |
| DOI | 10.3390/molecules24203739 |