PPIRE17452
Target Protein Information
| Protein_Name | Cytochrome c |
|---|---|
| Protein_Sequence | MGDVEKGKKIFVQKCAQCHTVEKGGKHKTGPNLHGLFGRKTGQAPGFTYTDANKNKGITWKEETLMEYLENPKKYIPGTKMIFAGIKKKTEREDLIAYLKKATNE |
| Organism_Source | Equus caballus |
| Functional_Classification | Cytochromes |
| Cellular_Localization | Mitochondria |
| Gene_Names | CYCS |
| UniProt_ID | P00004 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | K19 |
|---|---|
| Peptide_Sequence | KKKKKKKKKKKKKKKKKKK |
| Peptide_Length | 19 |
| Peptide_SMILES | NCCCC[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 2453.32 |
|---|---|
| Aliphatic_Index | 0.00000 |
| Aromaticity | 0.00000 |
| Average_Rotatable_Bonds | 5.94737 |
| Charge_at_pH_7 | 18.99238 |
| Isoelectric_Point | 12.05543 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 39 |
| Number_of_Hydrogen_Bond_Donors | 39 |
| Topological_Polar_Surface_Area | 1081.50000 |
| X_logP_energy | -7.42430 |
Interaction Information
| Affinity | KD=0.3 uM |
|---|---|
| Affinity_Assay | Resonance energy transfer |
| PDB_ID | None |
| Type | Inhibitor |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Dissociation of Cytochrome c from Liposomes by Histone H1. Comparison with Basic Peptides |
| Release_Year | 1996 |
| PMID | 8605203 |
| DOI | 10.1021/bi952413w |