PPIRE17498
Target Protein Information
| Protein_Name | Tat proofreading chaperone DmsD |
|---|---|
| Protein_Sequence | MTHFSQQDNFSVAARVLGALFYYAPESAEAAPLVAVLTSDGWETQWPLPEASLAPLVTAFQTQCEETHAQAWQRLFVGPWALPSPPWGSVWLDRESVLFGDSTLALRQWMREKGIQFEMKQNEPEDHFGSLLLMAAWLAENGRQTECEELLAWHLFPWSTRFLDVFIEKAEHPFYRALGELARLTLAQWQSQLLIPVAVKPLFR |
| Organism_Source | Escherichia coli O157:H7 |
| Functional_Classification | chaperones |
| Cellular_Localization | Cytoplasm |
| Gene_Names | dmsD |
| UniProt_ID | P69854 |
| Protein-Protein Interaction Networks | |
Peptide Basic Information
| Peptide_Name | DmsA signal peptide |
|---|---|
| Peptide_Sequence | SRRFLK |
| Peptide_Length | 6 |
| Peptide_SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](N)CO)C(=O)N[C@@H](CCCCN)C(=O)O |
| Chemical_Modification | None |
| Cyclization_Method | None |
| Linear/Cyclic | Linear |
| N-terminal_Modification | Free |
| C-terminal_Modification | Free |
| Amino_Acid_Distribution | |
|
|
|
Peptide Physicochemical
| Molecular_Weight | 805.98 |
|---|---|
| Aliphatic_Index | 65.00000 |
| Aromaticity | 0.16667 |
| Average_Rotatable_Bonds | 4.66667 |
| Charge_at_pH_7 | 2.99768 |
| Isoelectric_Point | 12.51648 |
|---|---|
| Number_of_Hydrogen_Bond_Acceptors | 11 |
| Number_of_Hydrogen_Bond_Donors | 15 |
| Topological_Polar_Surface_Area | 378.87000 |
| X_logP_energy | -3.24106 |
Interaction Information
| Affinity | KD=0.223 uM |
|---|---|
| Affinity_Assay | Isothermal Titration Calorimetry |
| PDB_ID | None |
| Type | Affinity ligand |
| Structure | |
Reference Information
| Document_Type | Research Articles |
|---|---|
| Title | Physical nature of signal peptide binding to DmsD |
| Release_Year | 2006 |
| PMID | 16996473 |
| DOI | 10.1016/j.abb.2006.08.009 |